CymitQuimica logo

CAS 898754-84-2

:

1-(2,4-dimethylphenyl)-3-(2,6-dimethylphenyl)propan-1-one

Description:
1-(2,4-Dimethylphenyl)-3-(2,6-dimethylphenyl)propan-1-one, with the CAS number 898754-84-2, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic rings, specifically 2,4-dimethylphenyl and 2,6-dimethylphenyl groups, which contribute to its unique chemical properties. This compound is typically characterized by its relatively high molecular weight and lipophilicity due to the presence of multiple methyl groups on the phenyl rings, which can influence its solubility and reactivity. It may exhibit interesting photochemical properties, making it relevant in applications such as organic synthesis and materials science. Additionally, the presence of multiple methyl groups can enhance its stability and alter its electronic properties, potentially affecting its behavior in chemical reactions. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity depending on exposure levels.
Formula:C19H22O
InChI:InChI=1/C19H22O/c1-13-8-9-18(16(4)12-13)19(20)11-10-17-14(2)6-5-7-15(17)3/h5-9,12H,10-11H2,1-4H3
SMILES:Cc1ccc(c(C)c1)C(=O)CCc1c(C)cccc1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.