CAS 898754-88-6
:1-Propanone, 1,3-bis(2,6-dimethylphenyl)-
Description:
1-Propanone, 1,3-bis(2,6-dimethylphenyl)-, also known as bis(2,6-dimethylphenyl) ketone, is an organic compound characterized by its ketone functional group. It features a propanone backbone with two bulky 2,6-dimethylphenyl groups attached to the first and third carbon atoms. This structure contributes to its relatively high molecular weight and low volatility. The compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its stability under standard conditions and is often used in organic synthesis and as an intermediate in the production of various chemical compounds. Due to the presence of the aromatic rings, it may exhibit significant hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Additionally, the steric hindrance from the dimethyl groups can influence its reactivity and interactions with other molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C19H22O
InChI:InChI=1S/C19H22O/c1-13-7-5-8-14(2)17(13)11-12-18(20)19-15(3)9-6-10-16(19)4/h5-10H,11-12H2,1-4H3
InChI key:InChIKey=WHLIZLMZAFERHA-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC=C1C)(=O)C2=C(C)C=CC=C2C
Synonyms:- 1-Propanone, 1,3-bis(2,6-dimethylphenyl)-
- 1,3-Bis(2,6-dimethylphenyl)-1-propanone
- 2′,6′-Dimethyl-3-(2,6-dimethylphenyl)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.