CAS 898754-89-7
:Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-, also known by its CAS number 898754-89-7, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound features a phenyl group that is further substituted with a 2,5-dimethyl group, contributing to its hydrophobic characteristics. The presence of the azetidine ring introduces a cyclic amine structure, which can influence the compound's reactivity and biological activity. Methanones are generally known for their potential applications in pharmaceuticals and organic synthesis, often serving as intermediates in the development of various bioactive compounds. The specific arrangement of substituents in this compound may affect its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C19H21NO
InChI:InChI=1S/C19H21NO/c1-14-8-9-15(2)18(12-14)19(21)17-7-4-3-6-16(17)13-20-10-5-11-20/h3-4,6-9,12H,5,10-11,13H2,1-2H3
InChI key:InChIKey=JVTNMJPIMFKLEF-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=C(C)C=CC(C)=C2)C=CC=C1)N3CCC3
Synonyms:- Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.