CAS 898754-91-1

Methanone, [2-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-, identified by CAS number 898754-91-1, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound contains a phenyl ring substituted with a 2-(1-azetidinylmethyl) group, indicating the presence of a five-membered nitrogen-containing heterocycle, which contributes to its biological activity and potential pharmacological properties. The additional 2,6-dimethylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. Methanone derivatives often exhibit diverse chemical reactivity, making them valuable in medicinal chemistry for the development of therapeutic agents. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can be significant in drug-receptor binding. Overall, this compound's unique structural features may confer specific properties that are of interest in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-14-7-5-8-15(2)18(14)19(21)17-10-4-3-9-16(17)13-20-11-6-12-20/h3-5,7-10H,6,11-13H2,1-2H3

InChI key: InChIKey=HFQUKQVHQVOEPY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• [2-(1-Azetidinylmethyl)phenyl](2,6-dimethylphenyl)methanone
• Methanone, [2-(1-azetidinylmethyl)phenyl](2,6-dimethylphenyl)-