CAS 898754-93-3

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-, with the CAS number 898754-93-3, is a chemical compound characterized by its complex structure that includes an azetidine ring and multiple aromatic groups. This compound features a ketone functional group, which is indicative of its classification as a methanone. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmacologically active compounds. The two methyl groups on the phenyl ring contribute to its hydrophobic characteristics, potentially influencing its solubility and reactivity. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in drug development and other fields.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-14-8-9-16(12-15(14)2)19(21)18-7-4-3-6-17(18)13-20-10-5-11-20/h3-4,6-9,12H,5,10-11,13H2,1-2H3

InChI key: InChIKey=XIMMJDJEBBBHSO-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(C)=C(C)C=C2)C=CC=C1)N3CCC3

Synonyms:

• [2-(1-Azetidinylmethyl)phenyl](3,4-dimethylphenyl)methanone
• Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dimethylphenyl)-