CAS 898754-95-5
:Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dimethylphenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dimethylphenyl)-, is an organic compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with a dimethyl group. The presence of the azetidine moiety suggests that it may exhibit unique steric and electronic properties, potentially influencing its reactivity and interactions with biological systems. This compound is likely to be a solid at room temperature, given the presence of multiple aromatic rings, which typically contribute to increased stability and melting points. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the azetidine ring, which is often found in biologically active compounds. Additionally, the specific arrangement of substituents may affect its solubility, polarity, and overall chemical behavior. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.
Formula:C19H21NO
InChI:InChI=1/C19H21NO/c1-14-10-15(2)12-17(11-14)19(21)18-7-4-3-6-16(18)13-20-8-5-9-20/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3
InChI key:InChIKey=WTAPUPVWRHDEAA-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=CC(C)=CC(C)=C2)C=CC=C1)N3CCC3
Synonyms:- Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dimethylphenyl)-
- [2-(1-Azetidinylmethyl)phenyl](3,5-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.