CAS 898754-96-6

1-(4-chloro-3-fluoro-phenyl)-3-(2,6-dimethylphenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(2,6-dimethylphenyl)propan-1-one, with the CAS number 898754-96-6, is a synthetic organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one aromatic ring and a dimethyl-substituted phenyl group on the other. This compound typically exhibits properties common to ketones, such as being a liquid at room temperature, with potential solubility in organic solvents. Its molecular structure suggests it may have significant lipophilicity, which could influence its biological activity and interactions. The presence of halogen substituents often enhances the compound's reactivity and may impart unique pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's specific functional groups may contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-4-3-5-12(2)14(11)7-9-17(20)13-6-8-15(18)16(19)10-13/h3-6,8,10H,7,9H2,1-2H3

SMILES: Cc1cccc(C)c1CCC(=O)c1ccc(c(c1)F)Cl

4′-chloro-3-(2,6-dimethylphenyl)-3′-fluoropropiophenone

CAS: 898754-96-6

Formula: C₁₇H₁₆ClFO

Purity: 97.0%

Molecular weight: 290.76

Ref: 10-F206546