CAS 898755-01-6
:[2-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone
Description:
The chemical substance known as [2-(azetidin-1-ylmethyl)phenyl]-(3-chloro-4-fluoro-phenyl)methanone, with the CAS number 898755-01-6, is a synthetic organic compound characterized by its complex structure, which includes an azetidine ring and a ketone functional group. This compound features a phenyl group substituted with both a chloro and a fluoro atom, contributing to its potential biological activity and chemical reactivity. The presence of the azetidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific stereochemical properties, influencing its pharmacological profile. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the phenyl rings and the azetidine nitrogen. Overall, this compound may have applications in drug development or as a research tool in various chemical and biological studies, although specific biological activities and properties would require further investigation.
Formula:C17H15ClFNO
InChI:InChI=1/C17H15ClFNO/c18-15-10-12(6-7-16(15)19)17(21)14-5-2-1-4-13(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2
SMILES:c1ccc(c(c1)CN1CCC1)C(=O)c1ccc(c(c1)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.