CAS 898755-02-7

1-Propanone, 3-(2,6-dimethylphenyl)-1-(2-fluorophenyl)-

Description:

1-Propanone, 3-(2,6-dimethylphenyl)-1-(2-fluorophenyl)-, also known by its CAS number 898755-02-7, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,6-dimethylphenyl group and a 2-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in reactivity and solubility compared to simpler ketones. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its reactivity in certain chemical reactions. Additionally, the dimethyl groups on the phenyl ring can affect steric hindrance and overall molecular stability. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its structural characteristics and potential applications. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-6-5-7-13(2)14(12)10-11-17(19)15-8-3-4-9-16(15)18/h3-9H,10-11H2,1-2H3

InChI key: InChIKey=WKAUFFAUMRRNTG-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(F)C=CC=C1)C2=C(C)C=CC=C2C

Synonyms:

• 1-Propanone, 3-(2,6-dimethylphenyl)-1-(2-fluorophenyl)-
• 3-(2,6-Dimethylphenyl)-1-(2-fluorophenyl)-1-propanone
• 3-(2,6-Dimethylphenyl)-2′-fluoropropiophenone

3-(2,6-dimethylphenyl)-2′-fluoropropiophenone

CAS: 898755-02-7

Formula: C₁₇H₁₇FO

Purity: 97.0%

Molecular weight: 256.32

Ref: 10-F206549