CymitQuimica logo

CAS 898755-04-9

:

3-(2,6-dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one

Description:
3-(2,6-Dimethylphenyl)-1-[2-(trifluoromethyl)phenyl]propan-1-one, with CAS number 898755-04-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone, which is substituted with two distinct aromatic groups: a 2,6-dimethylphenyl group and a 2-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its structural complexity suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of multiple substituents may affect its physical properties, such as melting point, boiling point, and solubility in various solvents. Safety data should be consulted for handling and storage, as the trifluoromethyl group can impart unique toxicological properties. Overall, this compound represents a class of substituted ketones with potential utility in various chemical applications.
Formula:C18H17F3O
InChI:InChI=1/C18H17F3O/c1-12-6-5-7-13(2)14(12)10-11-17(22)15-8-3-4-9-16(15)18(19,20)21/h3-9H,10-11H2,1-2H3
SMILES:Cc1cccc(C)c1CCC(=O)c1ccccc1C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.