CAS 898755-07-2

[2-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(azetidin-1-ylmethyl)phenyl]-[2-(trifluoromethyl)phenyl]methanone, with the CAS number 898755-07-2, is characterized by its complex molecular structure, which includes an azetidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethyl group often enhances lipophilicity and can influence biological activity, making it of interest in pharmaceutical research. The azetidine moiety may impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Additionally, the ketone functional group suggests the possibility of undergoing various chemical reactions, such as nucleophilic addition or reduction. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry and materials science, warranting further investigation into its properties and potential uses.

Formula: C₁₈H₁₆F₃NO

InChI: InChI=1/C18H16F3NO/c19-18(20,21)16-9-4-3-8-15(16)17(23)14-7-2-1-6-13(14)12-22-10-5-11-22/h1-4,6-9H,5,10-12H2

SMILES: c1ccc(c(c1)CN1CCC1)C(=O)c1ccccc1C(F)(F)F