CAS 898755-08-3

3-(2,6-dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one

Description:

3-(2,6-Dimethylphenyl)-1-[4-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898755-08-3, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a propan-1-one backbone substituted with two distinct aromatic groups: a 2,6-dimethylphenyl group and a 4-trifluoromethylphenyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its reactivity and biological activity. The dimethyl substitution on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its interactions in chemical reactions or biological systems. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features. Its properties, such as solubility, melting point, and stability, would depend on the specific conditions and environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups.

Formula: C₁₈H₁₇F₃O

InChI: InChI=1/C18H17F3O/c1-12-4-3-5-13(2)16(12)10-11-17(22)14-6-8-15(9-7-14)18(19,20)21/h3-9H,10-11H2,1-2H3

SMILES: Cc1cccc(C)c1CCC(=O)c1ccc(cc1)C(F)(F)F