CymitQuimica logo

CAS 898755-09-4

:

[2-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone

Description:
The chemical substance known as [2-(azetidin-1-ylmethyl)phenyl]-[3-(trifluoromethyl)phenyl]methanone, with the CAS number 898755-09-4, is a synthetic organic compound characterized by its complex structure that includes both an azetidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the trifluoromethyl group often enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. The azetidine moiety may contribute to its potential as a pharmacophore, impacting its binding affinity to biological targets. Additionally, the compound's functional groups suggest it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Overall, this compound's unique structural features position it as a candidate for further research in drug development and material science.
Formula:C18H16F3NO
InChI:InChI=1/C18H16F3NO/c19-18(20,21)15-7-3-6-13(11-15)17(23)16-8-2-1-5-14(16)12-22-9-4-10-22/h1-3,5-8,11H,4,9-10,12H2
SMILES:c1ccc(c(c1)CN1CCC1)C(=O)c1cccc(c1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.