CAS 898755-11-8

[2-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [2-(azetidin-1-ylmethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 898755-11-8, is characterized by its complex structure that includes both an azetidine ring and a trifluoromethyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmacologically active compounds. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making the compound of interest in drug design. Additionally, the compound's molecular structure may exhibit specific stereochemical properties, influencing its interactions with biological targets. Overall, this substance represents a unique combination of functional groups that may lead to interesting chemical behavior and potential applications in pharmaceuticals or agrochemicals. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₈H₁₆F₃NO

InChI: InChI=1/C18H16F3NO/c19-18(20,21)15-8-6-13(7-9-15)17(23)16-5-2-1-4-14(16)12-22-10-3-11-22/h1-2,4-9H,3,10-12H2

SMILES: c1ccc(c(c1)CN1CCC1)C(=O)c1ccc(cc1)C(F)(F)F