CAS 898755-12-9
:1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)-
Description:
1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)-, also known by its CAS number 898755-12-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2-chloro-4-fluorophenyl group and a 2,6-dimethylphenyl group. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity and physical properties, including its boiling point and solubility. The compound is likely to exhibit moderate polarity due to the electronegative halogen substituents, which can affect its interactions in various chemical environments. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential applications in organic synthesis or as an intermediate in pharmaceuticals. Safety data should be consulted for handling and storage, as compounds with halogenated substituents can pose specific health and environmental risks.
Formula:C17H16ClFO
InChI:InChI=1S/C17H16ClFO/c1-11-4-3-5-12(2)14(11)8-9-17(20)15-7-6-13(19)10-16(15)18/h3-7,10H,8-9H2,1-2H3
InChI key:InChIKey=AKPQWAMEFKBOEX-UHFFFAOYSA-N
SMILES:C(CCC1=C(C)C=CC=C1C)(=O)C2=C(Cl)C=C(F)C=C2
Synonyms:- 2′-Chloro-3-(2,6-dimethylphenyl)-4′-fluoropropiophenone
- 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)-
- 1-(2-Chloro-4-fluorophenyl)-3-(2,6-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.