CAS 898755-13-0
:Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromo-2-fluorophenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromo-2-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with both bromine and fluorine atoms. The presence of the azetidine ring indicates that it has a cyclic amine structure, contributing to its potential biological activity. This compound is likely to exhibit specific reactivity due to the electron-withdrawing effects of the bromine and fluorine substituents, which can influence its chemical behavior and interactions with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with such configurations often exhibit interesting pharmacological properties. Additionally, the presence of multiple functional groups may allow for diverse synthetic modifications, enhancing its utility in various chemical applications. However, detailed studies would be necessary to fully understand its properties, including solubility, stability, and reactivity under different conditions.
Formula:C17H15BrFNO
InChI:InChI=1S/C17H15BrFNO/c18-13-6-7-15(16(19)10-13)17(21)14-5-2-1-4-12(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2
InChI key:InChIKey=INDSJDSWVHEQIC-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(F)C=C(Br)C=C3
Synonyms:- [2-(1-Azetidinylmethyl)phenyl](4-bromo-2-fluorophenyl)methanone
- Methanone, [2-(1-azetidinylmethyl)phenyl](4-bromo-2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.