CAS 898755-14-1

1-(3-chloro-5-fluoro-phenyl)-3-(2,6-dimethylphenyl)propan-1-one

Description:

1-(3-chloro-5-fluoro-phenyl)-3-(2,6-dimethylphenyl)propan-1-one, with the CAS number 898755-14-1, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone, which is substituted with a 3-chloro-5-fluorophenyl group and a 2,6-dimethylphenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The bulky dimethylphenyl substituent may affect the steric hindrance and overall molecular conformation. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can impact its solubility in organic solvents and its behavior in biological systems. Additionally, the presence of multiple substituents suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, given the potential hazards associated with halogenated compounds.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-4-3-5-12(2)16(11)6-7-17(20)13-8-14(18)10-15(19)9-13/h3-5,8-10H,6-7H2,1-2H3

SMILES: Cc1cccc(C)c1CCC(=O)c1cc(cc(c1)F)Cl