CAS 898755-15-2

Methanone, [2-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with both a chloro and a fluoro group. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, which can influence its reactivity and biological activity. This compound is likely to exhibit specific pharmacological properties due to its unique structural features, making it of interest in medicinal chemistry. Its molecular interactions may be influenced by the electron-withdrawing effects of the chloro and fluoro substituents, which can affect the compound's lipophilicity and overall stability. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, including nucleophilic substitutions or electrophilic additions. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity associated with halogenated compounds. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₇H₁₅ClFNO

InChI: InChI=1S/C17H15ClFNO/c18-16-10-13(19)6-7-15(16)17(21)14-5-2-1-4-12(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=UUPYNPHSMBODOM-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(Cl)C=C(F)C=C3

Synonyms:

• Methanone, [2-(1-azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)-
• [2-(1-Azetidinylmethyl)phenyl](2-chloro-4-fluorophenyl)methanone