CAS 898755-19-6

Methanone, [2-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with both a chloro and a fluoro group. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, contributing to its potential biological activity. This compound may exhibit unique pharmacological properties due to its specific molecular configuration, which can influence its interactions with biological targets. The presence of halogen substituents, such as chlorine and fluorine, often enhances lipophilicity and can affect the compound's reactivity and stability. Additionally, the compound's molecular weight, solubility, and melting point would be influenced by its functional groups and overall structure. As with many synthetic organic compounds, understanding its characteristics is crucial for applications in medicinal chemistry, where it may serve as a lead compound for drug development or as a tool in biochemical research.

Formula: C₁₇H₁₅ClFNO

InChI: InChI=1S/C17H15ClFNO/c18-13-6-7-15(16(19)10-13)17(21)14-5-2-1-4-12(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=IALVUBJBDZHODZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(F)C=C(Cl)C=C3

Synonyms:

• Methanone, [2-(1-azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)-
• [2-(1-Azetidinylmethyl)phenyl](4-chloro-2-fluorophenyl)methanone