CAS 898755-21-0

Methanone, [2-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-, identified by CAS number 898755-21-0, is a chemical compound that features a methanone functional group, which is characterized by a carbonyl group (C=O) bonded to two distinct aromatic and aliphatic substituents. The presence of the azetidine ring indicates that it contains a four-membered nitrogen-containing heterocycle, contributing to its potential biological activity. The compound also includes a dichlorophenyl group, which suggests the presence of chlorine substituents on a phenyl ring, likely influencing its reactivity and solubility properties. Such structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit unique interactions with biological targets, potentially leading to applications in drug development. However, detailed studies would be necessary to elucidate its full chemical behavior, stability, and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1S/C17H15Cl2NO/c18-15-8-3-7-14(16(15)19)17(21)13-6-2-1-5-12(13)11-20-9-4-10-20/h1-3,5-8H,4,9-11H2

InChI key: InChIKey=LCEZZARQTKEDHJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• [2-(1-Azetidinylmethyl)phenyl](2,3-dichlorophenyl)methanone
• Methanone, [2-(1-azetidinylmethyl)phenyl](2,3-dichlorophenyl)-