CAS 898755-25-4

Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-, identified by its CAS number 898755-25-4, is a chemical compound that features a ketone functional group, specifically a methanone structure. This compound is characterized by the presence of a phenyl group substituted with dichlorine atoms at the 2 and 5 positions, which contributes to its chemical reactivity and potential biological activity. The azetidine moiety, a four-membered nitrogen-containing ring, is attached to the phenyl group, indicating that the compound may exhibit unique steric and electronic properties. Such structural features suggest that it may interact with biological targets, making it of interest in medicinal chemistry. The presence of halogen atoms often enhances lipophilicity and can influence the compound's pharmacokinetics. Overall, this compound's unique structure may lead to interesting applications in drug development or other chemical applications, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1S/C17H15Cl2NO/c18-13-6-7-16(19)15(10-13)17(21)14-5-2-1-4-12(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=PHYPGJMIRFCBJB-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(Cl)C=CC(Cl)=C2)C=CC=C1)N3CCC3

Synonyms:

• Methanone, [2-(1-azetidinylmethyl)phenyl](2,5-dichlorophenyl)-
• [2-(1-Azetidinylmethyl)phenyl](2,5-dichlorophenyl)methanone