CAS 898755-26-5
:1-(3,5-dichlorophenyl)-3-(2,6-dimethylphenyl)propan-1-one
Description:
1-(3,5-Dichlorophenyl)-3-(2,6-dimethylphenyl)propan-1-one, identified by its CAS number 898755-26-5, is an organic compound that belongs to the class of ketones. This substance features a propanone backbone with two distinct aromatic substituents: a 3,5-dichlorophenyl group and a 2,6-dimethylphenyl group. The presence of chlorine atoms in the phenyl ring contributes to its chemical reactivity and potential biological activity, while the dimethyl groups can influence its steric properties and solubility. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, due to the electron-withdrawing effects of the chlorine substituents. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its molecular structure and the surrounding environment. Overall, this compound's unique characteristics make it a subject of interest for further research and application in various fields.
Formula:C17H16Cl2O
InChI:InChI=1/C17H16Cl2O/c1-11-4-3-5-12(2)16(11)6-7-17(20)13-8-14(18)10-15(19)9-13/h3-5,8-10H,6-7H2,1-2H3
SMILES:Cc1cccc(C)c1CCC(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.