CAS 898755-27-6

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-, also known by its CAS number 898755-27-6, is a chemical compound characterized by its unique structure that includes an azetidine ring and dichlorophenyl groups. This compound typically exhibits properties associated with both its aromatic and aliphatic components, which may influence its reactivity and interactions with biological systems. The presence of the azetidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The dichlorophenyl group may enhance lipophilicity, affecting the compound's solubility and permeability. Additionally, the compound's molecular structure may confer specific electronic properties, influencing its stability and reactivity. Overall, Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-, represents a complex chemical entity with potential applications in drug discovery and development, warranting further investigation into its biological activity and therapeutic potential.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1S/C17H15Cl2NO/c18-15-7-6-12(10-16(15)19)17(21)14-5-2-1-4-13(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=BYYXPVOZQQVDHI-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Cl)=C(Cl)C=C2)C=CC=C1)N3CCC3

Synonyms:

• Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-dichlorophenyl)-