CAS 898755-29-8
:Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dichlorophenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dichlorophenyl)-, identified by its CAS number 898755-29-8, is a chemical compound that features a ketone functional group, specifically a methanone structure. This compound is characterized by the presence of a phenyl group substituted with dichlorine atoms at the 3 and 5 positions, which contributes to its chemical reactivity and potential biological activity. The azetidine ring, a four-membered nitrogen-containing heterocycle, is attached to the phenyl group, indicating that this compound may exhibit unique properties due to the steric and electronic effects of the azetidine moiety. The presence of halogen substituents often enhances lipophilicity and can influence the compound's pharmacokinetic properties. Overall, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific biological pathways or receptors. Further studies would be necessary to elucidate its full chemical behavior and potential applications.
Formula:C17H15Cl2NO
InChI:InChI=1S/C17H15Cl2NO/c18-14-8-13(9-15(19)10-14)17(21)16-5-2-1-4-12(16)11-20-6-3-7-20/h1-2,4-5,8-10H,3,6-7,11H2
InChI key:InChIKey=DPRZHRWOIIWESK-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=CC(Cl)=CC(Cl)=C2)C=CC=C1)N3CCC3
Synonyms:- Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.