CAS 898755-31-2

Methanone, [2-(1-azetidinylmethyl)phenyl](2,4-difluorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](2,4-difluorophenyl)-, identified by its CAS number 898755-31-2, is an organic compound characterized by its complex structure that includes a methanone functional group and a phenyl ring substituted with difluorine atoms. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmaceuticals and biologically active compounds. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its solubility and permeability in biological systems. The difluorophenyl group may enhance its metabolic stability and alter its interaction with biological targets. Additionally, the specific arrangement of substituents can affect its reactivity and potential applications in medicinal chemistry. Overall, this compound's unique structural features may contribute to its potential utility in drug development or as a research tool in chemical biology.

Formula: C₁₇H₁₅F₂NO

InChI: InChI=1/C17H15F2NO/c18-13-6-7-15(16(19)10-13)17(21)14-5-2-1-4-12(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=QRYMMPODOVNHQB-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCC2)C=CC=C1)C3=C(F)C=C(F)C=C3

Synonyms:

• [2-(1-Azetidinylmethyl)phenyl](2,4-difluorophenyl)methanone
• Methanone, [2-(1-azetidinylmethyl)phenyl](2,4-difluorophenyl)-