CAS 898755-33-4

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-

Description:

Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-, is a chemical compound characterized by its complex structure, which includes a methanone functional group and a phenyl ring substituted with difluorine atoms. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, contributing to its potential biological activity. This compound is likely to exhibit specific reactivity due to the electron-withdrawing effects of the difluorophenyl group, which can influence its interaction with biological targets. The azetidinylmethyl group may also enhance its lipophilicity, affecting its pharmacokinetic properties. Methanone derivatives often serve as intermediates in organic synthesis and can be explored for their potential therapeutic applications, particularly in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₇H₁₅F₂NO

InChI: InChI=1S/C17H15F2NO/c18-15-7-6-12(10-16(15)19)17(21)14-5-2-1-4-13(14)11-20-8-3-9-20/h1-2,4-7,10H,3,8-9,11H2

InChI key: InChIKey=ZRKIIWVYNKNIIY-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(F)=C(F)C=C2)C=CC=C1)N3CCC3

Synonyms:

• [2-(1-Azetidinylmethyl)phenyl](3,4-difluorophenyl)methanone
• Methanone, [2-(1-azetidinylmethyl)phenyl](3,4-difluorophenyl)-