CAS 898755-35-6
:Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-
Description:
Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-, is a chemical compound characterized by its unique structure that includes an azetidine ring and difluorophenyl groups. This compound features a ketone functional group, which is indicative of its classification as a methanone. The presence of the azetidine moiety suggests potential biological activity, as azetidines are often found in various pharmaceuticals. The difluorophenyl substituents enhance the compound's lipophilicity and may influence its reactivity and interaction with biological targets. The molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the specific arrangement of atoms and functional groups can affect the compound's physical properties, such as solubility and stability. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential pharmaceutical relevance.
Formula:C17H15F2NO
InChI:InChI=1S/C17H15F2NO/c18-14-8-13(9-15(19)10-14)17(21)16-5-2-1-4-12(16)11-20-6-3-7-20/h1-2,4-5,8-10H,3,6-7,11H2
InChI key:InChIKey=XHHDIUHBAUDCAU-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2=CC(F)=CC(F)=C2)C=CC=C1)N3CCC3
Synonyms:- Methanone, [2-(1-azetidinylmethyl)phenyl](3,5-difluorophenyl)-
- [2-(1-Azetidinylmethyl)phenyl](3,5-difluorophenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.