CAS 898755-36-7
:4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)butan-1-one
Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)butan-1-one, with the CAS number 898755-36-7, is a synthetic organic compound that belongs to the class of ketones. This compound features a complex structure characterized by a butanone backbone, which is substituted with a heptylphenyl group and a dioxane moiety. The presence of the dioxane ring contributes to its potential solubility in organic solvents and may influence its reactivity and stability. The heptylphenyl group enhances the hydrophobic characteristics of the molecule, which could affect its interactions in biological systems or materials science applications. This compound may exhibit interesting properties such as fluorescence or photostability, making it potentially useful in various fields, including organic electronics or as a dye. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization. As with many synthetic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C23H36O3
InChI:InChI=1/C23H36O3/c1-4-5-6-7-8-10-19-13-15-20(16-14-19)21(24)11-9-12-22-25-17-23(2,3)18-26-22/h13-16,22H,4-12,17-18H2,1-3H3
InChI key:InChIKey=FEVRIVHKMHDTPV-UHFFFAOYSA-N
SMILES:C(CCCC1OCC(C)(C)CO1)(=O)C2=CC=C(CCCCCCC)C=C2
Synonyms:- 4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-1-butanone
- 1-Butanone, 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-
- 4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-HEPTYLBUTYROPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.