CAS 898755-38-9
:[2-(azetidin-1-ylmethyl)phenyl]-(3,4,5-trifluorophenyl)methanone
Description:
The chemical substance known as [2-(azetidin-1-ylmethyl)phenyl]-(3,4,5-trifluorophenyl)methanone, with the CAS number 898755-38-9, is characterized by its complex molecular structure, which includes an azetidine ring and a trifluorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the trifluoromethyl groups enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The azetidine moiety can impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Additionally, the methanone functional group suggests the presence of a carbonyl, which can participate in various chemical reactions, such as nucleophilic attacks. Overall, this compound's characteristics make it a subject of interest for research in drug development and synthetic chemistry, particularly in the exploration of new therapeutic agents.
Formula:C17H14F3NO
InChI:InChI=1/C17H14F3NO/c18-14-8-12(9-15(19)16(14)20)17(22)13-5-2-1-4-11(13)10-21-6-3-7-21/h1-2,4-5,8-9H,3,6-7,10H2
SMILES:c1ccc(c(c1)CN1CCC1)C(=O)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.