
CAS 898755-41-4
:[2-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone
Description:
[2-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone, with the CAS number 898755-41-4, is a chemical compound characterized by its unique structural features, including a cyclopropyl group and an azetidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its reactivity and interaction with biological targets. The presence of the cyclopropyl group can impart strain and unique steric effects, potentially affecting its pharmacological activity. Additionally, the azetidine ring contributes to the compound's overall three-dimensional shape, which is crucial for binding interactions in biological systems. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, where modifications to its structure could enhance efficacy or reduce side effects. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions under which it is studied, including solvent choice and temperature. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C14H17NO
InChI:InChI=1S/C14H17NO/c16-14(11-6-7-11)13-5-2-1-4-12(13)10-15-8-3-9-15/h1-2,4-5,11H,3,6-10H2
InChI key:InChIKey=YMFSRRJXEAMNPX-UHFFFAOYSA-N
SMILES:C(C1=C(C(=O)C2CC2)C=CC=C1)N3CCC3
Synonyms:- [2-(1-Azetidinylmethyl)phenyl]cyclopropylmethanone
- Methanone, [2-(1-azetidinylmethyl)phenyl]cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.