CAS 898755-42-5
:5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-propylphenyl)-1-pentanone
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-propylphenyl)-1-pentanone, with the CAS number 898755-42-5, is an organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, which contributes to its potential applications in organic synthesis and as a building block in various chemical reactions. The presence of the 5,5-dimethyl-1,3-dioxan moiety suggests that it may exhibit unique solubility and stability properties, while the 4-propylphenyl group can influence its hydrophobicity and interaction with biological systems. Such compounds are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in the synthesis of more complex molecules. The specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which the compound is used. Safety data and handling precautions should be consulted due to the potential hazards associated with organic compounds.
Formula:C20H30O3
InChI:InChI=1S/C20H30O3/c1-4-7-16-10-12-17(13-11-16)18(21)8-5-6-9-19-22-14-20(2,3)15-23-19/h10-13,19H,4-9,14-15H2,1-3H3
InChI key:InChIKey=QIFFYAGZISWGEC-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC=C(CCC)C=C2
Synonyms:- 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-propylphenyl)-1-pentanone
- 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-propylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.