CAS 898755-43-6
:1-Cyclobutyl-3-(2,6-dimethylphenyl)-1-propanone
Description:
1-Cyclobutyl-3-(2,6-dimethylphenyl)-1-propanone, with the CAS number 898755-43-6, is an organic compound that belongs to the class of ketones. It features a cyclobutyl group and a 2,6-dimethylphenyl substituent, contributing to its unique structural and chemical properties. This compound is characterized by its relatively complex molecular structure, which influences its reactivity and interactions with other substances. As a ketone, it contains a carbonyl group (C=O) that is central to its chemical behavior, making it susceptible to nucleophilic attacks. The presence of the cyclobutyl ring can impart strain and affect the compound's stability and reactivity. Additionally, the dimethylphenyl group enhances its hydrophobic character, potentially influencing solubility in various solvents. This compound may be of interest in synthetic organic chemistry and could have applications in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and behavior in different chemical environments.
Formula:C15H20O
InChI:InChI=1S/C15H20O/c1-11-5-3-6-12(2)14(11)9-10-15(16)13-7-4-8-13/h3,5-6,13H,4,7-10H2,1-2H3
InChI key:InChIKey=IQOVZUIXRYMASR-UHFFFAOYSA-N
SMILES:C(CC(=O)C1CCC1)C2=C(C)C=CC=C2C
Synonyms:- 1-Propanone, 1-cyclobutyl-3-(2,6-dimethylphenyl)-
- 1-Cyclobutyl-3-(2,6-dimethylphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.