CAS 898755-54-9
:5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-1-pentanone
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-1-pentanone, with the CAS number 898755-54-9, is an organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. The presence of the dioxane moiety contributes to its potential solubility in organic solvents, while the heptylphenyl group enhances its hydrophobic characteristics. This compound may exhibit interesting physical properties such as a moderate boiling point and melting point, typical of larger organic molecules. Its structure suggests potential applications in fields such as materials science, pharmaceuticals, or as a specialty chemical, where its unique properties could be leveraged. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C24H38O3
InChI:InChI=1S/C24H38O3/c1-4-5-6-7-8-11-20-14-16-21(17-15-20)22(25)12-9-10-13-23-26-18-24(2,3)19-27-23/h14-17,23H,4-13,18-19H2,1-3H3
InChI key:InChIKey=WASWHLZLAREPJK-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC=C(CCCCCCC)C=C2
Synonyms:- 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-
- 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-heptylphenyl)-1-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.