CymitQuimica logo

CAS 898755-57-2

:

3-(3,4-dimethylphenyl)-1-(m-tolyl)propan-1-one

Description:
3-(3,4-Dimethylphenyl)-1-(m-tolyl)propan-1-one, with the CAS number 898755-57-2, is an organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic groups: a 3,4-dimethylphenyl group and an m-tolyl group. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the presence of the hydrophobic aromatic rings. The presence of multiple methyl groups enhances its hydrophobic character while potentially influencing its reactivity and interaction with biological systems. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. Its specific applications can vary, but it may be of interest in fields such as organic synthesis, pharmaceuticals, or materials science. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C18H20O
InChI:InChI=1/C18H20O/c1-13-5-4-6-17(11-13)18(19)10-9-16-8-7-14(2)15(3)12-16/h4-8,11-12H,9-10H2,1-3H3
SMILES:Cc1cccc(c1)C(=O)CCc1ccc(C)c(C)c1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.