CAS 898755-62-9
:5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1-methylethyl)phenyl]-1-pentanone
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1-methylethyl)phenyl]-1-pentanone, with the CAS number 898755-62-9, is an organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, which contributes to its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the dioxane moiety suggests that it may exhibit unique solubility and stability properties, while the isopropyl-substituted phenyl group can influence its reactivity and interaction with other molecules. Such compounds are often studied for their potential use in pharmaceuticals, agrochemicals, or as flavoring agents due to their structural diversity. Additionally, the presence of multiple functional groups may allow for various chemical modifications, making it a versatile compound in synthetic organic chemistry. However, specific safety and handling information should be consulted from reliable sources, as with any chemical substance.
Formula:C20H30O3
InChI:InChI=1/C20H30O3/c1-15(2)16-9-11-17(12-10-16)18(21)7-5-6-8-19-22-13-20(3,4)14-23-19/h9-12,15,19H,5-8,13-14H2,1-4H3
InChI key:InChIKey=KRKMDHPUZOOZHH-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC=C(C(C)C)C=C2
Synonyms:- 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1-methylethyl)phenyl]-1-pentanone
- 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-[4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.