CAS 898755-68-5
:3-(3,4-dimethylphenyl)-1-(4-methoxyphenyl)propan-1-one
Description:
3-(3,4-Dimethylphenyl)-1-(4-methoxyphenyl)propan-1-one, with the CAS number 898755-68-5, is a synthetic organic compound that belongs to the class of ketones. It features a propanone backbone substituted with two aromatic groups: a 3,4-dimethylphenyl group and a 4-methoxyphenyl group. This compound is characterized by its relatively complex structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methoxy group enhances its electron-donating ability, potentially influencing its reactivity and interactions in various chemical environments. Additionally, due to its structural features, this compound may be of interest in fields such as organic synthesis, medicinal chemistry, and materials science. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C18H20O2
InChI:InChI=1/C18H20O2/c1-13-4-5-15(12-14(13)2)6-11-18(19)16-7-9-17(20-3)10-8-16/h4-5,7-10,12H,6,11H2,1-3H3
SMILES:Cc1ccc(CCC(=O)c2ccc(cc2)OC)cc1C
Synonyms:- 1-Propanone, 3-(3,4-dimethylphenyl)-1-(4-methoxyphenyl)-
- 3-(3,4-DIMETHYLPHENYL)-4'-METHOXYPROPIOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.