CAS 898755-70-9
:5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1,1-dimethylethyl)phenyl]-1-pentanone
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1,1-dimethylethyl)phenyl]-1-pentanone, with the CAS number 898755-70-9, is an organic compound characterized by its complex structure, which includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, indicating the presence of a five-carbon chain with a ketone at one end. The dioxane moiety contributes to its stability and solubility properties, while the bulky tert-butyl group attached to the phenyl ring enhances its steric hindrance, potentially influencing its reactivity and interactions in various chemical environments. The presence of multiple functional groups suggests that this compound may exhibit interesting chemical behavior, making it suitable for applications in organic synthesis, pharmaceuticals, or as a specialty chemical. Its specific properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization or computational modeling.
Formula:C21H32O3
InChI:InChI=1S/C21H32O3/c1-20(2,3)17-12-10-16(11-13-17)18(22)8-6-7-9-19-23-14-21(4,5)15-24-19/h10-13,19H,6-9,14-15H2,1-5H3
InChI key:InChIKey=RGVQNINKLZTDLX-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC=C(C(C)(C)C)C=C2
Synonyms:- 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-[4-(1,1-dimethylethyl)phenyl]-
- 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[4-(1,1-dimethylethyl)phenyl]-1-pentanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.