CAS 898755-75-4

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)-1-butanone

Description:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)-1-butanone, with the CAS number 898755-75-4, is an organic compound characterized by its complex structure, which includes a dioxane ring and a butanone moiety. This compound features a dioxan-2-yl group that contributes to its stability and solubility in various organic solvents. The presence of the ethoxyphenyl group enhances its potential for applications in organic synthesis and as a building block in pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit interesting chemical reactivity, particularly in electrophilic substitution reactions due to the presence of the aromatic ring. Additionally, the compound's unique functional groups may impart specific physical properties, such as boiling and melting points, which are influenced by intermolecular interactions. While specific data on its toxicity and environmental impact may not be readily available, compounds of this nature typically require careful handling and assessment in laboratory settings. Overall, this compound represents a versatile structure with potential utility in various chemical applications.

Formula: C₁₈H₂₆O₄

InChI: InChI=1S/C18H26O4/c1-4-20-16-10-6-5-8-14(16)15(19)9-7-11-17-21-12-18(2,3)13-22-17/h5-6,8,10,17H,4,7,9,11-13H2,1-3H3

InChI key: InChIKey=FALSBGJLRCITLS-UHFFFAOYSA-N

SMILES: C(CCCC1OCC(C)(C)CO1)(=O)C2=C(OCC)C=CC=C2

Synonyms:

• 4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)-1-butanone
• 1-Butanone, 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)-