CAS 898755-77-6

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methylphenyl)-

Description:

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methylphenyl)-, identified by its CAS number 898755-77-6, is a complex organic compound featuring a spirocyclic structure. This substance contains a methanone functional group, which is characterized by a carbonyl group (C=O) bonded to two organic moieties. The presence of a 1,4-dioxa moiety indicates that the compound includes two oxygen atoms in a cyclic arrangement, contributing to its unique chemical properties. The spirocyclic structure, which involves a connection between two rings at a single atom, often imparts distinctive steric and electronic characteristics, potentially influencing its reactivity and interactions with biological systems. Additionally, the presence of phenyl groups suggests that the compound may exhibit aromatic properties, which can affect its stability and solubility. Overall, this compound's structural complexity may lead to interesting applications in medicinal chemistry or materials science, although specific biological or chemical properties would require further investigation.

Formula: C₂₂H₂₅NO₃

InChI: InChI=1S/C22H25NO3/c1-17-6-8-18(9-7-17)21(24)20-5-3-2-4-19(20)16-23-12-10-22(11-13-23)25-14-15-26-22/h2-9H,10-16H2,1H3

InChI key: InChIKey=WHVJLNXWDPBAMJ-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=CC=C(C)C=C4)C=CC=C3

Synonyms:

• [2-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methylphenyl)methanone
• Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methylphenyl)-

2-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-4′-methyl benzophenone

CAS: 898755-77-6

Formula: C₂₂H₂₅NO₃

Purity: 97.0%

Molecular weight: 351.446

Ref: 10-F205340