CAS 898755-78-7
:5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)pentan-1-one
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-ethoxyphenyl)pentan-1-one, with the CAS number 898755-78-7, is a synthetic organic compound characterized by its complex structure, which includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, indicating the presence of a five-carbon chain with a ketone at one end. The dioxane moiety contributes to its stability and solubility properties, while the ethoxyphenyl group enhances its potential for various applications, possibly in pharmaceuticals or as a chemical intermediate. The presence of multiple functional groups suggests that it may exhibit interesting reactivity and could be utilized in organic synthesis or as a building block in the development of more complex molecules. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the surrounding environment. As with many synthetic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C19H28O4
InChI:InChI=1/C19H28O4/c1-4-21-17-11-7-5-9-15(17)16(20)10-6-8-12-18-22-13-19(2,3)14-23-18/h5,7,9,11,18H,4,6,8,10,12-14H2,1-3H3
SMILES:CCOc1ccccc1C(=O)CCCCC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.