CAS 898755-80-1

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](3-methoxyphenyl)-

Description:

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](3-methoxyphenyl)-, identified by its CAS number 898755-80-1, is a complex organic compound characterized by its unique structural features. This substance contains a methanone functional group, which is indicative of a ketone, and incorporates a spirocyclic structure that contributes to its three-dimensional conformation. The presence of a 1,4-dioxa moiety suggests potential for interesting chemical reactivity and interactions, particularly in coordination chemistry or as a ligand. The compound also features aromatic rings, which can enhance its stability and influence its electronic properties. Additionally, the methoxy group attached to one of the phenyl rings may impart solubility characteristics and affect the compound's reactivity. Overall, this compound's intricate structure may lead to diverse applications in fields such as medicinal chemistry, materials science, or as a potential pharmacophore in drug development. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications.

Formula: C₂₂H₂₅NO₄

InChI: InChI=1S/C22H25NO4/c1-25-19-7-4-6-17(15-19)21(24)20-8-3-2-5-18(20)16-23-11-9-22(10-12-23)26-13-14-27-22/h2-8,15H,9-14,16H2,1H3

InChI key: InChIKey=NMLBIGBGWGPZHW-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=CC(OC)=CC=C4)C=CC=C3

Synonyms:

• Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](3-methoxyphenyl)-

2-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-3′-methoxy benzophenone

CAS: 898755-80-1

Formula: C₂₂H₂₅NO₄

Purity: 97.0%

Molecular weight: 367.445

Ref: 10-F205342