CAS 898755-81-2
:4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)butan-1-one
Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)butan-1-one, with the CAS number 898755-81-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a butanone moiety. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature and having moderate volatility. Its structure suggests potential applications in various fields, including pharmaceuticals and materials science, due to the presence of functional groups that can participate in chemical reactions. The dioxane ring may contribute to its solubility in organic solvents, while the isopropoxyphenyl group could enhance its hydrophobic characteristics. Additionally, the compound may exhibit specific biological activities, making it of interest for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity depending on exposure levels.
Formula:C19H28O4
InChI:InChI=1/C19H28O4/c1-14(2)23-16-10-8-15(9-11-16)17(20)6-5-7-18-21-12-19(3,4)13-22-18/h8-11,14,18H,5-7,12-13H2,1-4H3
SMILES:CC(C)Oc1ccc(cc1)C(=O)CCCC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.