CAS 898755-82-3

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methoxyphenyl)-

Description:

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methoxyphenyl)-, identified by its CAS number 898755-82-3, is a complex organic compound featuring a spirocyclic structure. This substance contains multiple functional groups, including a methanone (ketone) moiety and ether linkages due to the presence of dioxane rings. The spirocyclic structure contributes to its unique three-dimensional conformation, which can influence its chemical reactivity and biological activity. The presence of methoxy and phenyl groups suggests potential for interactions in various chemical environments, making it of interest in medicinal chemistry and material science. The compound's solubility, stability, and reactivity would depend on its molecular structure and the nature of substituents. Additionally, the presence of nitrogen in the spirocyclic framework may impart basic properties, affecting its interactions with other molecules. Overall, this compound's intricate structure and functional groups make it a candidate for further research in various applications, including pharmaceuticals and organic synthesis.

Formula: C₂₂H₂₅NO₄

InChI: InChI=1S/C22H25NO4/c1-25-19-8-6-17(7-9-19)21(24)20-5-3-2-4-18(20)16-23-12-10-22(11-13-23)26-14-15-27-22/h2-9H,10-16H2,1H3

InChI key: InChIKey=KVRGRIVARSFEAH-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=CC=C(OC)C=C4)C=CC=C3

Synonyms:

• Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methoxyphenyl)-
• [2-(1,4-Dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl](4-methoxyphenyl)methanone

2-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-4′-methoxy benzophenone

CAS: 898755-82-3

Formula: C₂₂H₂₅NO₄

Purity: 97.0%

Molecular weight: 367.445

Ref: 10-F205343