CAS 898755-83-4
:5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)pentan-1-one
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-isopropoxyphenyl)pentan-1-one, with the CAS number 898755-83-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, indicating the presence of a five-carbon chain with a ketone at one end. The presence of the isopropoxyphenyl group suggests potential applications in organic synthesis or as a building block in pharmaceuticals. The dioxane moiety contributes to the compound's stability and solubility properties, while the branched dimethyl groups may influence its steric hindrance and reactivity. Overall, this compound's unique structure may impart specific physical and chemical properties, such as solubility in organic solvents and potential interactions with biological systems, making it of interest in various fields, including medicinal chemistry and materials science. However, detailed studies would be necessary to fully elucidate its behavior and applications.
Formula:C20H30O4
InChI:InChI=1/C20H30O4/c1-15(2)24-17-11-9-16(10-12-17)18(21)7-5-6-8-19-22-13-20(3,4)14-23-19/h9-12,15,19H,5-8,13-14H2,1-4H3
SMILES:CC(C)Oc1ccc(cc1)C(=O)CCCCC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.