CymitQuimica logo

CAS 898755-86-7

:

4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)butan-1-one

Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)butan-1-one, with the CAS number 898755-86-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxane ring and a phenoxyphenyl group. This compound typically exhibits properties associated with both ketones and ethers due to the presence of the carbonyl group and the ether linkage, respectively. It is likely to be a solid at room temperature, with potential applications in fields such as pharmaceuticals or materials science, given its structural features. The presence of the dioxane moiety may impart certain solubility characteristics, while the phenyl groups can influence its electronic properties and reactivity. As with many organic compounds, its behavior in various chemical environments, including stability under different pH conditions and reactivity with nucleophiles or electrophiles, would be of interest for practical applications. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C22H26O4
InChI:InChI=1/C22H26O4/c1-22(2)15-24-21(25-16-22)10-6-9-20(23)17-11-13-19(14-12-17)26-18-7-4-3-5-8-18/h3-5,7-8,11-14,21H,6,9-10,15-16H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2ccc(cc2)Oc2ccccc2)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.