CAS 898755-88-9

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)-1-pentanone

Description:

5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)-1-pentanone, with the CAS number 898755-88-9, is an organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, which contributes to its potential applications in various chemical reactions and synthesis processes. The presence of the phenoxyphenyl group enhances its aromatic characteristics, potentially influencing its solubility and reactivity. The dimethyl dioxane moiety may impart stability and steric hindrance, affecting the compound's interaction with other molecules. Such compounds are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is analyzed. Overall, this compound exemplifies the complexity and diversity of organic chemistry, showcasing how structural variations can lead to different chemical behaviors and applications.

Formula: C₂₃H₂₈O₄

InChI: InChI=1S/C23H28O4/c1-23(2)16-25-22(26-17-23)11-7-6-10-21(24)18-12-14-20(15-13-18)27-19-8-4-3-5-9-19/h3-5,8-9,12-15,22H,6-7,10-11,16-17H2,1-2H3

InChI key: InChIKey=KQPRDRBDBLRGMF-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(CCCCC2OCC(C)(C)CO2)=O)C=C1)C3=CC=CC=C3

Synonyms:

• 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)-1-pentanone
• 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-phenoxyphenyl)-