CAS 898755-91-4

1-[3,5-bis(trifluoromethyl)phenyl]-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one

Description:

1-[3,5-bis(trifluoromethyl)phenyl]-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898755-91-4, is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety and a dioxane ring. The presence of trifluoromethyl groups on the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dioxane component contributes to the compound's stability and solubility in organic solvents. This compound may exhibit unique reactivity due to the electron-withdrawing nature of the trifluoromethyl groups, potentially affecting its interactions in various chemical environments. Its specific applications can vary, but it may be explored in fields such as pharmaceuticals or agrochemicals, where such structural features are often linked to desirable properties. As with many synthetic compounds, safety and handling precautions should be observed, given the potential hazards associated with its chemical structure.

Formula: C₁₈H₂₀F₆O₃

InChI: InChI=1/C18H20F6O3/c1-16(2)9-26-15(27-10-16)5-3-4-14(25)11-6-12(17(19,20)21)8-13(7-11)18(22,23)24/h6-8,15H,3-5,9-10H2,1-2H3

SMILES: CC1(C)COC(CCCC(=O)c2cc(cc(c2)C(F)(F)F)C(F)(F)F)OC1

bis-3′,5′-trifluoromethyl-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone

CAS: 898755-91-4

Formula: C₁₈H₂₀F₆O₃

Purity: 97.0%

Molecular weight: 398.345

Ref: 10-F208403