CAS 898755-93-6

1-[3,5-bis(trifluoromethyl)phenyl]-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one

Description:

1-[3,5-bis(trifluoromethyl)phenyl]-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-1-one, with the CAS number 898755-93-6, is a synthetic organic compound characterized by its complex structure, which includes a pentanone backbone and multiple functional groups. The presence of trifluoromethyl groups on the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The dioxane moiety contributes to the compound's stability and solubility in organic solvents. This compound is likely to exhibit unique chemical reactivity due to the electron-withdrawing nature of the trifluoromethyl groups, which can affect its interaction with other molecules. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many synthetic compounds, safety and handling precautions should be observed, given the potential hazards associated with fluorinated compounds. Overall, this compound represents a fascinating example of modern synthetic chemistry with implications in various fields.

Formula: C₁₉H₂₂F₆O₃

InChI: InChI=1/C19H22F6O3/c1-17(2)10-27-16(28-11-17)6-4-3-5-15(26)12-7-13(18(20,21)22)9-14(8-12)19(23,24)25/h7-9,16H,3-6,10-11H2,1-2H3

SMILES: CC1(C)COC(CCCCC(=O)c2cc(cc(c2)C(F)(F)F)C(F)(F)F)OC1