CAS 898755-94-7

Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(methylthio)phenyl]-

Description:

Methanone, specifically the compound with the name "2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(methylthio)phenyl]-," is a complex organic molecule characterized by its unique structural features, including a spirocyclic framework and multiple functional groups. The presence of a methanone functional group indicates that it contains a carbonyl group (C=O) bonded to a carbon atom, which is part of a larger molecular structure. The compound also features a dioxane ring and an azaspiro structure, contributing to its potential biological activity and chemical reactivity. The methylthio group suggests the presence of sulfur, which can influence the compound's electronic properties and interactions. This compound may exhibit interesting pharmacological properties due to its intricate structure, making it a candidate for further research in medicinal chemistry. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₂₂H₂₅NO₃S

InChI: InChI=1S/C22H25NO3S/c1-27-20-9-5-4-8-19(20)21(24)18-7-3-2-6-17(18)16-23-12-10-22(11-13-23)25-14-15-26-22/h2-9H,10-16H2,1H3

InChI key: InChIKey=LMMFPFMGPCUCNR-UHFFFAOYSA-N

SMILES: C(N1CCC2(CC1)OCCO2)C3=C(C(=O)C4=C(SC)C=CC=C4)C=CC=C3

Synonyms:

• Methanone, [2-(1,4-dioxa-8-azaspiro[4.5]dec-8-ylmethyl)phenyl][2-(methylthio)phenyl]-

2-[8-(1,4-dioxa-8-azaspiro[4.5]decyl)methyl]-2′-thiomethyl benzophenone

CAS: 898755-94-7

Formula: C₂₂H₂₅NO₃S

Purity: 97.0%

Molecular weight: 383.51

Ref: 10-F205350