CAS 898756-11-1

1-(2,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone

Description:

1-(2,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone, with the CAS number 898756-11-1, is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety and a dioxane ring. This compound features a dimethoxyphenyl group, which contributes to its potential aromatic properties and may influence its reactivity and solubility. The presence of the dioxane ring suggests that it may exhibit unique chemical behavior, particularly in terms of stability and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, solubility, and reactivity, would depend on the compound's molecular interactions and the functional groups present. As with many organic compounds, safety data and handling precautions are essential, particularly regarding toxicity and environmental impact. Further research and characterization would be necessary to fully understand its properties and potential applications.

Formula: C₁₈H₂₆O₅

InChI: InChI=1S/C18H26O5/c1-18(2)11-22-17(23-12-18)7-5-6-15(19)14-10-13(20-3)8-9-16(14)21-4/h8-10,17H,5-7,11-12H2,1-4H3

InChI key: InChIKey=URDWSYLABVHZKF-UHFFFAOYSA-N

SMILES: C(CCCC1OCC(C)(C)CO1)(=O)C2=C(OC)C=CC(OC)=C2

Synonyms:

• 1-(2,5-Dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-butanone
• 1-Butanone, 1-(2,5-dimethoxyphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)-